C15H23NO4S — CID 177153487
tert-butyl N-[(2,4,6-trimethylphenyl)sulfinylmethoxy]carbamate (PubChem CID 177153487) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is tert-butyl N-[(2,4,6-trimethylphenyl)sulfinylmethoxy]carbamate.
| Compound Name | tert-butyl N-[(2,4,6-trimethylphenyl)sulfinylmethoxy]carbamate |
|---|---|
| PubChem CID | 177153487 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | tert-butyl N-[(2,4,6-trimethylphenyl)sulfinylmethoxy]carbamate |
| SMILES | Cc1cc(C)c(S(=O)CONC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C15H23NO4S/c1-10-7-11(2)13(12(3)8-10)21(18)9-19-16-14(17)20-15(4,5)6/h7-8H,9H2,1-6H3,(H,16,17) |
| InChIKey | NRDVHHAPKDXGNS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|