C9H3F13O3 — CID 11058590
methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,2,2-trifluoroethenoxy)hexanoate (PubChem CID 11058590) has the molecular formula C9H3F13O3 and a molecular weight of 406.09 g/mol. Its IUPAC name is methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,2,2-trifluoroethenoxy)hexanoate.
| Compound Name | methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,2,2-trifluoroethenoxy)hexanoate |
|---|---|
| PubChem CID | 11058590 |
| Molecular Formula | C9H3F13O3 |
| Molecular Weight | 406.09 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | methyl 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,2,2-trifluoroethenoxy)hexanoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C9H3F13O3/c1-24-4(23)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)25-3(12)2(10)11/h1H3 |
| InChIKey | QHQSQYHPVPEXSY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|