C8H3F9O3 — CID 20541670
methyl 2,2,3,3,4,4,6,7,7-nonafluoro-5-oxohept-6-enoate (PubChem CID 20541670) has the molecular formula C8H3F9O3 and a molecular weight of 318.09 g/mol. Its IUPAC name is methyl 2,2,3,3,4,4,6,7,7-nonafluoro-5-oxohept-6-enoate.
| Compound Name | methyl 2,2,3,3,4,4,6,7,7-nonafluoro-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 20541670 |
| Molecular Formula | C8H3F9O3 |
| Molecular Weight | 318.09 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | methyl 2,2,3,3,4,4,6,7,7-nonafluoro-5-oxohept-6-enoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)C(F)=C(F)F |
| InChI | InChI=1S/C8H3F9O3/c1-20-5(19)7(14,15)8(16,17)6(12,13)3(18)2(9)4(10)11/h1H3 |
| InChIKey | HVYDHXWIGOKTBC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|