C5F7IO — CID 141020576
1,1,2,4,4,5,5-heptafluoro-5-iodopent-1-en-3-one (PubChem CID 141020576) has the molecular formula C5F7IO and a molecular weight of 335.94 g/mol. Its IUPAC name is 1,1,2,4,4,5,5-heptafluoro-5-iodopent-1-en-3-one.
| Compound Name | 1,1,2,4,4,5,5-heptafluoro-5-iodopent-1-en-3-one |
|---|---|
| PubChem CID | 141020576 |
| Molecular Formula | C5F7IO |
| Molecular Weight | 335.94 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | 1,1,2,4,4,5,5-heptafluoro-5-iodopent-1-en-3-one |
| SMILES | O=C(C(F)=C(F)F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C5F7IO/c6-1(3(7)8)2(14)4(9,10)5(11,12)13 |
| InChIKey | DZIHYKXYFOTJJR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.94 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|