C15H15F18IN2O — CID 175320398
N',N'-diethylmethanediamine;1,1,2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodec-1-en-3-one;hydroiodide (PubChem CID 175320398) has the molecular formula C15H15F18IN2O and a molecular weight of 708.17 g/mol. Its IUPAC name is N',N'-diethylmethanediamine;1,1,2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodec-1-en-3-one;hydroiodide.
| Compound Name | N',N'-diethylmethanediamine;1,1,2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodec-1-en-3-one;hydroiodide |
|---|---|
| PubChem CID | 175320398 |
| Molecular Formula | C15H15F18IN2O |
| Molecular Weight | 708.17 g/mol |
| Exact Mass | 707.99 |
| IUPAC Name | N',N'-diethylmethanediamine;1,1,2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodec-1-en-3-one;hydroiodide |
| SMILES | CCN(CC)CN.I.O=C(C(F)=C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F18O.C5H14N2.HI/c11-1(3(12)13)2(29)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)28;1-3-7(4-2)5-6;/h;3-6H2,1-2H3;1H |
| InChIKey | IUSKEWKYBDVBEY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.17 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|