C4HF6IO2 — CID 19898069
2,2,3,4,4,4-hexafluoro-3-iodobutanoic acid (PubChem CID 19898069) has the molecular formula C4HF6IO2 and a molecular weight of 321.94 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluoro-3-iodobutanoic acid.
| Compound Name | 2,2,3,4,4,4-hexafluoro-3-iodobutanoic acid |
|---|---|
| PubChem CID | 19898069 |
| Molecular Formula | C4HF6IO2 |
| Molecular Weight | 321.94 g/mol |
| Exact Mass | 321.89 |
| IUPAC Name | 2,2,3,4,4,4-hexafluoro-3-iodobutanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(I)C(F)(F)F |
| InChI | InChI=1S/C4HF6IO2/c5-2(6,1(12)13)3(7,11)4(8,9)10/h(H,12,13) |
| InChIKey | FJVQAVKFKLASHY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|