C4H5F5NaO3 — CID 161395602
CID 161395602 (PubChem CID 161395602) has the molecular formula C4H5F5NaO3 and a molecular weight of 219.06 g/mol.
| Compound Name | CID 161395602 |
|---|---|
| PubChem CID | 161395602 |
| Molecular Formula | C4H5F5NaO3 |
| Molecular Weight | 219.06 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | — |
| SMILES | CO.O=C(O)C(F)(F)C(F)(F)F.[Na] |
| InChI | InChI=1S/C3HF5O2.CH4O.Na/c4-2(5,1(9)10)3(6,7)8;1-2;/h(H,9,10);2H,1H3; |
| InChIKey | CBVLCFNGQUOIOY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.06 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|