C10H12F10N2O4 — CID 131849469
bis(2,2,3,3,3-pentafluoropropanoic acid);piperazine (PubChem CID 131849469) has the molecular formula C10H12F10N2O4 and a molecular weight of 414.20 g/mol. Its IUPAC name is bis(2,2,3,3,3-pentafluoropropanoic acid);piperazine.
| Compound Name | bis(2,2,3,3,3-pentafluoropropanoic acid);piperazine |
|---|---|
| PubChem CID | 131849469 |
| Molecular Formula | C10H12F10N2O4 |
| Molecular Weight | 414.20 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | bis(2,2,3,3,3-pentafluoropropanoic acid);piperazine |
| SMILES | C1CNCCN1.O=C(O)C(F)(F)C(F)(F)F.O=C(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H10N2.2C3HF5O2/c1-2-6-4-3-5-1;2*4-2(5,1(9)10)3(6,7)8/h5-6H,1-4H2;2*(H,9,10) |
| InChIKey | WEXDJQCTJXMIKP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|