C6H6F6O3 — CID 88623685
methyl 2,2,3,3,4,4-hexafluoro-5-hydroxypentanoate (PubChem CID 88623685) has the molecular formula C6H6F6O3 and a molecular weight of 240.10 g/mol. Its IUPAC name is methyl 2,2,3,3,4,4-hexafluoro-5-hydroxypentanoate.
| Compound Name | methyl 2,2,3,3,4,4-hexafluoro-5-hydroxypentanoate |
|---|---|
| PubChem CID | 88623685 |
| Molecular Formula | C6H6F6O3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | methyl 2,2,3,3,4,4-hexafluoro-5-hydroxypentanoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C6H6F6O3/c1-15-3(14)5(9,10)6(11,12)4(7,8)2-13/h13H,2H2,1H3 |
| InChIKey | QNYGLXZMOFWFII-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|