C6ClF9O2 — CID 131719956
2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanoyl chloride (PubChem CID 131719956) has the molecular formula C6ClF9O2 and a molecular weight of 310.50 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanoyl chloride.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanoyl chloride |
|---|---|
| PubChem CID | 131719956 |
| Molecular Formula | C6ClF9O2 |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanoyl chloride |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C6ClF9O2/c7-3(17)4(11,12)5(13,14)6(15,16)18-2(10)1(8)9 |
| InChIKey | JATBFGSWUVFGBI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|