C10H10F9NO2 — CID 154161384
N,N-diethyl-2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanamide (PubChem CID 154161384) has the molecular formula C10H10F9NO2 and a molecular weight of 347.18 g/mol. Its IUPAC name is N,N-diethyl-2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanamide.
| Compound Name | N,N-diethyl-2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanamide |
|---|---|
| PubChem CID | 154161384 |
| Molecular Formula | C10H10F9NO2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N,N-diethyl-2,2,3,3,4,4-hexafluoro-4-(1,2,2-trifluoroethenoxy)butanamide |
| SMILES | CCN(CC)C(=O)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C10H10F9NO2/c1-3-20(4-2)7(21)8(14,15)9(16,17)10(18,19)22-6(13)5(11)12/h3-4H2,1-2H3 |
| InChIKey | SQZIDPRFJYEEJS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|