C9H4F13NO2 — CID 175997151
2,2,3,3,4,4,5,5,6,6-decafluoro-N-methyl-6-(1,2,2-trifluoroethenoxy)hexanamide (PubChem CID 175997151) has the molecular formula C9H4F13NO2 and a molecular weight of 405.11 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-N-methyl-6-(1,2,2-trifluoroethenoxy)hexanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-N-methyl-6-(1,2,2-trifluoroethenoxy)hexanamide |
|---|---|
| PubChem CID | 175997151 |
| Molecular Formula | C9H4F13NO2 |
| Molecular Weight | 405.11 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-N-methyl-6-(1,2,2-trifluoroethenoxy)hexanamide |
| SMILES | CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C9H4F13NO2/c1-23-4(24)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)25-3(12)2(10)11/h1H3,(H,23,24) |
| InChIKey | BHAWYZQVRPULOF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.11 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|