C7H6ClF6NO2 — CID 71672503
(propan-2-ylideneamino) 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 71672503) has the molecular formula C7H6ClF6NO2 and a molecular weight of 285.57 g/mol. Its IUPAC name is (propan-2-ylideneamino) 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | (propan-2-ylideneamino) 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 71672503 |
| Molecular Formula | C7H6ClF6NO2 |
| Molecular Weight | 285.57 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (propan-2-ylideneamino) 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | CC(C)=NOC(=O)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6ClF6NO2/c1-3(2)15-17-4(16)5(8,6(9,10)11)7(12,13)14/h1-2H3 |
| InChIKey | QEERAXPMKSCHLU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|