C9H15NO3 — CID 162411492
[(E)-3-oxobutan-2-ylideneamino] 2,2-dimethylpropanoate (PubChem CID 162411492) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is [(E)-3-oxobutan-2-ylideneamino] 2,2-dimethylpropanoate.
| Compound Name | [(E)-3-oxobutan-2-ylideneamino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162411492 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | [(E)-3-oxobutan-2-ylideneamino] 2,2-dimethylpropanoate |
| SMILES | CC(=O)/C(C)=N/OC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H15NO3/c1-6(7(2)11)10-13-8(12)9(3,4)5/h1-5H3/b10-6+ |
| InChIKey | HLGIFJBZKWZHPB-UXBLZVDNSA-N |
| XLogP | 1.54 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|