C14H19NO3 — CID 138968016
[(E)-1-(3-methoxyphenyl)ethylideneamino] 2,2-dimethylpropanoate (PubChem CID 138968016) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is [(E)-1-(3-methoxyphenyl)ethylideneamino] 2,2-dimethylpropanoate.
| Compound Name | [(E)-1-(3-methoxyphenyl)ethylideneamino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138968016 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [(E)-1-(3-methoxyphenyl)ethylideneamino] 2,2-dimethylpropanoate |
| SMILES | COc1cccc(/C(C)=N/OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19NO3/c1-10(15-18-13(16)14(2,3)4)11-7-6-8-12(9-11)17-5/h6-9H,1-5H3/b15-10+ |
| InChIKey | NWAMVTRLTZAHGL-XNTDXEJSSA-N |
| XLogP | 3.01 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|