C8H12O7 — CID 157086316
(2S)-2-[(2R,3R)-2,3-dihydroxy-4-oxopentanoyl]oxypropanoic acid (PubChem CID 157086316) has the molecular formula C8H12O7 and a molecular weight of 220.18 g/mol. Its IUPAC name is (2S)-2-[(2R,3R)-2,3-dihydroxy-4-oxopentanoyl]oxypropanoic acid.
| Compound Name | (2S)-2-[(2R,3R)-2,3-dihydroxy-4-oxopentanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 157086316 |
| Molecular Formula | C8H12O7 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (2S)-2-[(2R,3R)-2,3-dihydroxy-4-oxopentanoyl]oxypropanoic acid |
| SMILES | CC(=O)[C@H](O)[C@@H](O)C(=O)O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C8H12O7/c1-3(9)5(10)6(11)8(14)15-4(2)7(12)13/h4-6,10-11H,1-2H3,(H,12,13)/t4-,5-,6+/m0/s1 |
| InChIKey | HMXBIZLJOPUGLP-HCWXCVPCSA-N |
| XLogP | -1.69 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |