C24H29N9O12+2 — CID 175674745
dihydroxy(oxo)azanium;2-[[1-[2-[[1-[2-(pyridine-3-carbonylamino)ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl nitrate;nitrate (PubChem CID 175674745) has the molecular formula C24H29N9O12+2 and a molecular weight of 635.55 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-[[1-[2-[[1-[2-(pyridine-3-carbonylamino)ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl nitrate;nitrate.
| Compound Name | dihydroxy(oxo)azanium;2-[[1-[2-[[1-[2-(pyridine-3-carbonylamino)ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl nitrate;nitrate |
|---|---|
| PubChem CID | 175674745 |
| Molecular Formula | C24H29N9O12+2 |
| Molecular Weight | 635.55 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | dihydroxy(oxo)azanium;2-[[1-[2-[[1-[2-(pyridine-3-carbonylamino)ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl]pyridin-1-ium-3-carbonyl]amino]ethyl nitrate;nitrate |
| SMILES | O=C(NCCO[N+](=O)[O-])c1ccc[n+](CCNC(=O)c2ccc[n+](CCNC(=O)c3cccnc3)c2)c1.O=[N+](O)O.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C24H25N7O6.H2NO3.NO3/c32-22(19-4-1-7-25-16-19)26-8-13-29-11-2-5-20(17-29)23(33)27-9-14-30-12-3-6-21(18-30)24(34)28-10-15-37-31(35)36;2*2-1(3)4/h1-7,11-12,16-18H,8-10,13-15H2,(H-2,26,27,28,32,33,34);(H2,2,3,4);/q;+1;-1/p+2 |
| InChIKey | CKLBVJMVKJUTJE-UHFFFAOYSA-P |
| XLogP | -1.24 |
| TPSA | 287.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.55 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|