C16H25N4O6+ — CID 88995804
[3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl N,N-di(propan-2-yl)carbamate (PubChem CID 88995804) has the molecular formula C16H25N4O6+ and a molecular weight of 369.40 g/mol. Its IUPAC name is [3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl N,N-di(propan-2-yl)carbamate.
| Compound Name | [3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 88995804 |
| Molecular Formula | C16H25N4O6+ |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | [3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OC[n+]1cccc(C(=O)NCCO[N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C16H24N4O6/c1-12(2)19(13(3)4)16(22)25-11-18-8-5-6-14(10-18)15(21)17-7-9-26-20(23)24/h5-6,8,10,12-13H,7,9,11H2,1-4H3/p+1 |
| InChIKey | IDJDGTVXMMQIAO-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|