C18H28N4O6+2 — CID 123646907
2-[[1-(1-cyclohexylethylcarbamoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium (PubChem CID 123646907) has the molecular formula C18H28N4O6+2 and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[[1-(1-cyclohexylethylcarbamoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium.
| Compound Name | 2-[[1-(1-cyclohexylethylcarbamoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 123646907 |
| Molecular Formula | C18H28N4O6+2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[[1-(1-cyclohexylethylcarbamoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium |
| SMILES | CC(NC(=O)OC[n+]1cccc(C(=O)NCCO[N+](=O)O)c1)C1CCCCC1 |
| InChI | InChI=1S/C18H26N4O6/c1-14(15-6-3-2-4-7-15)20-18(24)27-13-21-10-5-8-16(12-21)17(23)19-9-11-28-22(25)26/h5,8,10,12,14-15H,2-4,6-7,9,11,13H2,1H3,(H-2,19,20,23,24,25,26)/p+2 |
| InChIKey | NEUDVJQCTUYBDY-UHFFFAOYSA-P |
| XLogP | 1.46 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|