C17H28N3O8S+ — CID 160724673
(3S)-3-[[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid;methanesulfonic acid (PubChem CID 160724673) has the molecular formula C17H28N3O8S+ and a molecular weight of 434.49 g/mol. Its IUPAC name is (3S)-3-[[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid;methanesulfonic acid.
| Compound Name | (3S)-3-[[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 160724673 |
| Molecular Formula | C17H28N3O8S+ |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (3S)-3-[[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid;methanesulfonic acid |
| SMILES | CC(C)C[C@H](CNC(=O)OC[n+]1cccc(C(N)=O)c1)CC(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C16H23N3O5.CH4O3S/c1-11(2)6-12(7-14(20)21)8-18-16(23)24-10-19-5-3-4-13(9-19)15(17)22;1-5(2,3)4/h3-5,9,11-12H,6-8,10H2,1-2H3,(H3-,17,18,20,21,22,23);1H3,(H,2,3,4)/p+1/t12-;/m0./s1 |
| InChIKey | LOYWMOVSIDNHGQ-YDALLXLXSA-O |
| XLogP | 0.40 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|