C18H24N2O9 — CID 10341588
5-methyl-3-[[[3-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]hexanoic acid (PubChem CID 10341588) has the molecular formula C18H24N2O9 and a molecular weight of 412.40 g/mol. Its IUPAC name is 5-methyl-3-[[[3-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]hexanoic acid.
| Compound Name | 5-methyl-3-[[[3-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]hexanoic acid |
|---|---|
| PubChem CID | 10341588 |
| Molecular Formula | C18H24N2O9 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-methyl-3-[[[3-(nitrooxymethyl)benzoyl]oxymethoxycarbonylamino]methyl]hexanoic acid |
| SMILES | CC(C)CC(CNC(=O)OCOC(=O)c1cccc(CO[N+](=O)[O-])c1)CC(=O)O |
| InChI | InChI=1S/C18H24N2O9/c1-12(2)6-14(8-16(21)22)9-19-18(24)28-11-27-17(23)15-5-3-4-13(7-15)10-29-20(25)26/h3-5,7,12,14H,6,8-11H2,1-2H3,(H,19,24)(H,21,22) |
| InChIKey | IFQYNARJSHUAOQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|