C18H24N2O9 — CID 91172214
2-[(S)-(methoxycarbonylamino)-[3-(nitrooxymethyl)benzoyl]oxymethyl]-5-methylhexanoic acid (PubChem CID 91172214) has the molecular formula C18H24N2O9 and a molecular weight of 412.40 g/mol. Its IUPAC name is 2-[(S)-(methoxycarbonylamino)-[3-(nitrooxymethyl)benzoyl]oxymethyl]-5-methylhexanoic acid.
| Compound Name | 2-[(S)-(methoxycarbonylamino)-[3-(nitrooxymethyl)benzoyl]oxymethyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 91172214 |
| Molecular Formula | C18H24N2O9 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[(S)-(methoxycarbonylamino)-[3-(nitrooxymethyl)benzoyl]oxymethyl]-5-methylhexanoic acid |
| SMILES | COC(=O)N[C@@H](OC(=O)c1cccc(CO[N+](=O)[O-])c1)C(CCC(C)C)C(=O)O |
| InChI | InChI=1S/C18H24N2O9/c1-11(2)7-8-14(16(21)22)15(19-18(24)27-3)29-17(23)13-6-4-5-12(9-13)10-28-20(25)26/h4-6,9,11,14-15H,7-8,10H2,1-3H3,(H,19,24)(H,21,22)/t14?,15-/m0/s1 |
| InChIKey | SXOZJSFOXFYUTQ-LOACHALJSA-N |
| XLogP | 2.37 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|