C15H26N2O9 — CID 87367836
(3S)-5-methyl-3-[[1-(4-nitrooxybutanoyloxy)ethoxycarbonylamino]methyl]hexanoic acid (PubChem CID 87367836) has the molecular formula C15H26N2O9 and a molecular weight of 378.38 g/mol. Its IUPAC name is (3S)-5-methyl-3-[[1-(4-nitrooxybutanoyloxy)ethoxycarbonylamino]methyl]hexanoic acid.
| Compound Name | (3S)-5-methyl-3-[[1-(4-nitrooxybutanoyloxy)ethoxycarbonylamino]methyl]hexanoic acid |
|---|---|
| PubChem CID | 87367836 |
| Molecular Formula | C15H26N2O9 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (3S)-5-methyl-3-[[1-(4-nitrooxybutanoyloxy)ethoxycarbonylamino]methyl]hexanoic acid |
| SMILES | CC(C)C[C@H](CNC(=O)OC(C)OC(=O)CCCO[N+](=O)[O-])CC(=O)O |
| InChI | InChI=1S/C15H26N2O9/c1-10(2)7-12(8-13(18)19)9-16-15(21)26-11(3)25-14(20)5-4-6-24-17(22)23/h10-12H,4-9H2,1-3H3,(H,16,21)(H,18,19)/t11?,12-/m0/s1 |
| InChIKey | RLPWJINJFNMXBM-KIYNQFGBSA-N |
| XLogP | 1.73 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|