C36H48CaN2O12 — CID 66864521
calcium bis((3S)-3-[[[(1S)-1-benzoyloxyethoxy]carbonylamino]methyl]-5-methylhexanoate) (PubChem CID 66864521) has the molecular formula C36H48CaN2O12 and a molecular weight of 740.86 g/mol. Its IUPAC name is calcium bis((3S)-3-[[[(1S)-1-benzoyloxyethoxy]carbonylamino]methyl]-5-methylhexanoate).
| Compound Name | calcium bis((3S)-3-[[[(1S)-1-benzoyloxyethoxy]carbonylamino]methyl]-5-methylhexanoate) |
|---|---|
| PubChem CID | 66864521 |
| Molecular Formula | C36H48CaN2O12 |
| Molecular Weight | 740.86 g/mol |
| Exact Mass | 740.28 |
| IUPAC Name | calcium bis((3S)-3-[[[(1S)-1-benzoyloxyethoxy]carbonylamino]methyl]-5-methylhexanoate) |
| SMILES | CC(C)CC(CNC(=O)OC(C)OC(=O)c1ccccc1)CC(=O)[O-].CC(C)CC(CNC(=O)O[C@@H](C)OC(=O)c1ccccc1)CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C18H25NO6.Ca/c2*1-12(2)9-14(10-16(20)21)11-19-18(23)25-13(3)24-17(22)15-7-5-4-6-8-15;/h2*4-8,12-14H,9-11H2,1-3H3,(H,19,23)(H,20,21);/q;;+2/p-2/t13-,14?;;/m0../s1 |
| InChIKey | OQCQFEQKQBHNBC-RBUUAABPSA-L |
| XLogP | 3.06 |
| TPSA | 209.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|