C18H25NO6 — CID 68993286
[(1S)-1-(5-methylhexanoyloxymethylcarbamoyloxy)ethyl] benzoate (PubChem CID 68993286) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is [(1S)-1-(5-methylhexanoyloxymethylcarbamoyloxy)ethyl] benzoate.
| Compound Name | [(1S)-1-(5-methylhexanoyloxymethylcarbamoyloxy)ethyl] benzoate |
|---|---|
| PubChem CID | 68993286 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [(1S)-1-(5-methylhexanoyloxymethylcarbamoyloxy)ethyl] benzoate |
| SMILES | CC(C)CCCC(=O)OCNC(=O)O[C@@H](C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H25NO6/c1-13(2)8-7-11-16(20)23-12-19-18(22)25-14(3)24-17(21)15-9-5-4-6-10-15/h4-6,9-10,13-14H,7-8,11-12H2,1-3H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | IPCAYSVUVZYVMO-AWEZNQCLSA-N |
| XLogP | 3.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|