C37H40O12 — CID 167287860
2-O-(1-benzoyloxypropan-2-yl) 1-O-[2-[6-(2-benzoyloxypropoxy)-6-oxohexanoyl]oxypropyl] benzene-1,2-dicarboxylate (PubChem CID 167287860) has the molecular formula C37H40O12 and a molecular weight of 676.72 g/mol. Its IUPAC name is 2-O-(1-benzoyloxypropan-2-yl) 1-O-[2-[6-(2-benzoyloxypropoxy)-6-oxohexanoyl]oxypropyl] benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(1-benzoyloxypropan-2-yl) 1-O-[2-[6-(2-benzoyloxypropoxy)-6-oxohexanoyl]oxypropyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 167287860 |
| Molecular Formula | C37H40O12 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | 2-O-(1-benzoyloxypropan-2-yl) 1-O-[2-[6-(2-benzoyloxypropoxy)-6-oxohexanoyl]oxypropyl] benzene-1,2-dicarboxylate |
| SMILES | CC(COC(=O)c1ccccc1C(=O)OC(C)COC(=O)c1ccccc1)OC(=O)CCCCC(=O)OCC(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H40O12/c1-25(47-33(39)21-13-12-20-32(38)44-22-26(2)48-35(41)29-16-8-5-9-17-29)23-46-36(42)30-18-10-11-19-31(30)37(43)49-27(3)24-45-34(40)28-14-6-4-7-15-28/h4-11,14-19,25-27H,12-13,20-24H2,1-3H3 |
| InChIKey | WJDHHHLBUSRKDR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|