About 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate
6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate (PubChem CID 118243756) has the molecular formula C26H30O8
and a molecular weight of 470.52 g/mol. Its IUPAC name is 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate.
Molecular Properties
| Compound Name | 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate |
| PubChem CID | 118243756 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate |
| SMILES | CC(COC(=O)c1ccccc1)OC(=O)CCCCC(=O)OCC(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H30O8/c1-19(18-32-25(29)21-11-5-3-6-12-21)33-24(28)16-10-9-15-23(27)31-17-20(2)34-26(30)22-13-7-4-8-14-22/h3-8,11-14,19-20H,9-10,15-18H2,1-2H3 |
| InChIKey | BDMRUDOHISRIMQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate?
The IUPAC name of 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate (CID 118243756) is 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate.
What is the SMILES notation for 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate?
The canonical SMILES for 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate is CC(COC(=O)c1ccccc1)OC(=O)CCCCC(=O)OCC(C)OC(=O)c1ccccc1.
What is the InChIKey of 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate?
The InChIKey is BDMRUDOHISRIMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30O8/c1-19(18-32-25(29)21-11-5-3-6-12-21)33-24(28)16-10-9-15-23(27)31-17-20(2)34-26(30)22-13-7-4-8-14-22/h3-8,11-14,19-20H,9-10,15-18H2,1-2H3.
What are the key properties of 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate?
6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate has a molecular weight of 470.52 g/mol, XLogP of 4.12, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-(1-benzoyloxypropan-2-yl) 1-O-(2-benzoyloxypropyl) hexanedioate is sourced from PubChem (CID 118243756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).