C13H16NNaO6S — CID 140649451
sodium 3-(1-benzoyloxyethoxycarbonylamino)propane-1-sulfinate (PubChem CID 140649451) has the molecular formula C13H16NNaO6S and a molecular weight of 337.33 g/mol. Its IUPAC name is sodium 3-(1-benzoyloxyethoxycarbonylamino)propane-1-sulfinate.
| Compound Name | sodium 3-(1-benzoyloxyethoxycarbonylamino)propane-1-sulfinate |
|---|---|
| PubChem CID | 140649451 |
| Molecular Formula | C13H16NNaO6S |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | sodium 3-(1-benzoyloxyethoxycarbonylamino)propane-1-sulfinate |
| SMILES | CC(OC(=O)NCCCS(=O)[O-])OC(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C13H17NO6S.Na/c1-10(19-12(15)11-6-3-2-4-7-11)20-13(16)14-8-5-9-21(17)18;/h2-4,6-7,10H,5,8-9H2,1H3,(H,14,16)(H,17,18);/q;+1/p-1 |
| InChIKey | OGLFIOYGNNIZIG-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|