C17H32N2O11 — CID 88913236
(3S)-3-[[1-[2-[(2S)-2-(dihydroxyamino)oxy-3-methoxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]-5-methylhexanoic acid (PubChem CID 88913236) has the molecular formula C17H32N2O11 and a molecular weight of 440.45 g/mol. Its IUPAC name is (3S)-3-[[1-[2-[(2S)-2-(dihydroxyamino)oxy-3-methoxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[1-[2-[(2S)-2-(dihydroxyamino)oxy-3-methoxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 88913236 |
| Molecular Formula | C17H32N2O11 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (3S)-3-[[1-[2-[(2S)-2-(dihydroxyamino)oxy-3-methoxypropoxy]acetyl]oxyethoxycarbonylamino]methyl]-5-methylhexanoic acid |
| SMILES | COC[C@@H](COCC(=O)OC(C)OC(=O)NC[C@H](CC(=O)O)CC(C)C)ON(O)O |
| InChI | InChI=1S/C17H32N2O11/c1-11(2)5-13(6-15(20)21)7-18-17(23)29-12(3)28-16(22)10-27-9-14(8-26-4)30-19(24)25/h11-14,24-25H,5-10H2,1-4H3,(H,18,23)(H,20,21)/t12?,13-,14-/m0/s1 |
| InChIKey | YCDMGJOZHJDGGZ-TTZKSVMKSA-N |
| XLogP | 0.78 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|