C16H25NO7 — CID 141234355
3-[[(3,5-dihydroxy-2-methyl-4-oxocyclopenten-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid (PubChem CID 141234355) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[[(3,5-dihydroxy-2-methyl-4-oxocyclopenten-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid.
| Compound Name | 3-[[(3,5-dihydroxy-2-methyl-4-oxocyclopenten-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 141234355 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-[[(3,5-dihydroxy-2-methyl-4-oxocyclopenten-1-yl)methoxycarbonylamino]methyl]-5-methylhexanoic acid |
| SMILES | CC1=C(COC(=O)NCC(CC(=O)O)CC(C)C)C(O)C(=O)C1O |
| InChI | InChI=1S/C16H25NO7/c1-8(2)4-10(5-12(18)19)6-17-16(23)24-7-11-9(3)13(20)15(22)14(11)21/h8,10,13-14,20-21H,4-7H2,1-3H3,(H,17,23)(H,18,19) |
| InChIKey | BBXNOUYDTUBKRI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|