C13H24N2O5 — CID 104877611
(3S)-3-[[(2-amino-3-ethoxy-3-oxopropanoyl)amino]methyl]-5-methylhexanoic acid (PubChem CID 104877611) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is (3S)-3-[[(2-amino-3-ethoxy-3-oxopropanoyl)amino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[(2-amino-3-ethoxy-3-oxopropanoyl)amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 104877611 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (3S)-3-[[(2-amino-3-ethoxy-3-oxopropanoyl)amino]methyl]-5-methylhexanoic acid |
| SMILES | CCOC(=O)C(N)C(=O)NC[C@H](CC(=O)O)CC(C)C |
| InChI | InChI=1S/C13H24N2O5/c1-4-20-13(19)11(14)12(18)15-7-9(5-8(2)3)6-10(16)17/h8-9,11H,4-7,14H2,1-3H3,(H,15,18)(H,16,17)/t9-,11?/m0/s1 |
| InChIKey | CZQTWZQCMSNBAL-FTNKSUMCSA-N |
| XLogP | 0.13 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|