C13H26N2O3S — CID 65494329
(3S)-3-[[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]methyl]-5-methylhexanoic acid (PubChem CID 65494329) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is (3S)-3-[[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 65494329 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3S)-3-[[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]methyl]-5-methylhexanoic acid |
| SMILES | CSCC[C@H](N)C(=O)NC[C@H](CC(=O)O)CC(C)C |
| InChI | InChI=1S/C13H26N2O3S/c1-9(2)6-10(7-12(16)17)8-15-13(18)11(14)4-5-19-3/h9-11H,4-8,14H2,1-3H3,(H,15,18)(H,16,17)/t10-,11-/m0/s1 |
| InChIKey | CIVHVPAYAQSEAY-QWRGUYRKSA-N |
| XLogP | 1.32 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |