C17H34N2O3 — CID 87608945
3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-5-methylnonanoic acid (PubChem CID 87608945) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is 3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-5-methylnonanoic acid.
| Compound Name | 3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-5-methylnonanoic acid |
|---|---|
| PubChem CID | 87608945 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 3-[[[(2S)-2-amino-4-methylpentanoyl]amino]methyl]-5-methylnonanoic acid |
| SMILES | CCCCC(C)CC(CNC(=O)[C@@H](N)CC(C)C)CC(=O)O |
| InChI | InChI=1S/C17H34N2O3/c1-5-6-7-13(4)9-14(10-16(20)21)11-19-17(22)15(18)8-12(2)3/h12-15H,5-11,18H2,1-4H3,(H,19,22)(H,20,21)/t13?,14?,15-/m0/s1 |
| InChIKey | PCEJTZVSQFUFPI-NRXISQOPSA-N |
| XLogP | 2.78 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |