C12H27ClN2O2 — CID 119790717
(2S)-2-amino-N-(2-ethyl-4-hydroxybutyl)-4-methylpentanamide;hydrochloride (PubChem CID 119790717) has the molecular formula C12H27ClN2O2 and a molecular weight of 266.81 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-ethyl-4-hydroxybutyl)-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-(2-ethyl-4-hydroxybutyl)-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119790717 |
| Molecular Formula | C12H27ClN2O2 |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (2S)-2-amino-N-(2-ethyl-4-hydroxybutyl)-4-methylpentanamide;hydrochloride |
| SMILES | CCC(CCO)CNC(=O)[C@@H](N)CC(C)C.Cl |
| InChI | InChI=1S/C12H26N2O2.ClH/c1-4-10(5-6-15)8-14-12(16)11(13)7-9(2)3;/h9-11,15H,4-8,13H2,1-3H3,(H,14,16);1H/t10?,11-;/m0./s1 |
| InChIKey | KXMUEURTROSRPZ-GQNCZFCYSA-N |
| XLogP | 1.31 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |