C15H24N2O3 — CID 114350596
2-amino-N-(2-ethyl-4-hydroxybutyl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 114350596) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-amino-N-(2-ethyl-4-hydroxybutyl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | 2-amino-N-(2-ethyl-4-hydroxybutyl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 114350596 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-amino-N-(2-ethyl-4-hydroxybutyl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | CCC(CCO)CNC(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H24N2O3/c1-2-11(7-8-18)10-17-15(20)14(16)9-12-3-5-13(19)6-4-12/h3-6,11,14,18-19H,2,7-10,16H2,1H3,(H,17,20) |
| InChIKey | VYOYVKNTKSVKRX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |