C12H18N2O4 — CID 104905303
(2R)-2-amino-N-(2,3-dihydroxypropyl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 104905303) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,3-dihydroxypropyl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2R)-2-amino-N-(2,3-dihydroxypropyl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 104905303 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2R)-2-amino-N-(2,3-dihydroxypropyl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | N[C@H](Cc1ccc(O)cc1)C(=O)NCC(O)CO |
| InChI | InChI=1S/C12H18N2O4/c13-11(12(18)14-6-10(17)7-15)5-8-1-3-9(16)4-2-8/h1-4,10-11,15-17H,5-7,13H2,(H,14,18)/t10?,11-/m1/s1 |
| InChIKey | KQWJPIPDXVOKGS-RRKGBCIJSA-N |
| XLogP | -1.27 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |