C12H23NO5S — CID 104517686
(3S)-5-methyl-3-[(2-methylsulfonylpropanoylamino)methyl]hexanoic acid (PubChem CID 104517686) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is (3S)-5-methyl-3-[(2-methylsulfonylpropanoylamino)methyl]hexanoic acid.
| Compound Name | (3S)-5-methyl-3-[(2-methylsulfonylpropanoylamino)methyl]hexanoic acid |
|---|---|
| PubChem CID | 104517686 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3S)-5-methyl-3-[(2-methylsulfonylpropanoylamino)methyl]hexanoic acid |
| SMILES | CC(C)C[C@H](CNC(=O)C(C)S(C)(=O)=O)CC(=O)O |
| InChI | InChI=1S/C12H23NO5S/c1-8(2)5-10(6-11(14)15)7-13-12(16)9(3)19(4,17)18/h8-10H,5-7H2,1-4H3,(H,13,16)(H,14,15)/t9?,10-/m0/s1 |
| InChIKey | YSZBEUBDXDEVEE-AXDSSHIGSA-N |
| XLogP | 0.67 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |