C18H24N2O9 — CID 68783492
3-[(1S)-1-amino-2-[[4-(nitrooxymethyl)benzoyl]oxymethoxy]-2-oxoethyl]-5-methylhexanoic acid (PubChem CID 68783492) has the molecular formula C18H24N2O9 and a molecular weight of 412.40 g/mol. Its IUPAC name is 3-[(1S)-1-amino-2-[[4-(nitrooxymethyl)benzoyl]oxymethoxy]-2-oxoethyl]-5-methylhexanoic acid.
| Compound Name | 3-[(1S)-1-amino-2-[[4-(nitrooxymethyl)benzoyl]oxymethoxy]-2-oxoethyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 68783492 |
| Molecular Formula | C18H24N2O9 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-[(1S)-1-amino-2-[[4-(nitrooxymethyl)benzoyl]oxymethoxy]-2-oxoethyl]-5-methylhexanoic acid |
| SMILES | CC(C)CC(CC(=O)O)[C@H](N)C(=O)OCOC(=O)c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H24N2O9/c1-11(2)7-14(8-15(21)22)16(19)18(24)28-10-27-17(23)13-5-3-12(4-6-13)9-29-20(25)26/h3-6,11,14,16H,7-10,19H2,1-2H3,(H,21,22)/t14?,16-/m0/s1 |
| InChIKey | QDZODGLTTBAJEM-WMCAAGNKSA-N |
| XLogP | 1.52 |
| TPSA | 168.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|