C23H26N3O8P+2 — CID 177333018
2-[[1-[bis(phenylmethoxy)phosphoryloxymethyl]pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium (PubChem CID 177333018) has the molecular formula C23H26N3O8P+2 and a molecular weight of 503.45 g/mol. Its IUPAC name is 2-[[1-[bis(phenylmethoxy)phosphoryloxymethyl]pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium.
| Compound Name | 2-[[1-[bis(phenylmethoxy)phosphoryloxymethyl]pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 177333018 |
| Molecular Formula | C23H26N3O8P+2 |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 2-[[1-[bis(phenylmethoxy)phosphoryloxymethyl]pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium |
| SMILES | O=C(NCCO[N+](=O)O)c1ccc[n+](COP(=O)(OCc2ccccc2)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H25N3O8P/c27-23(24-13-15-31-26(28)29)22-12-7-14-25(16-22)19-34-35(30,32-17-20-8-3-1-4-9-20)33-18-21-10-5-2-6-11-21/h1-12,14,16H,13,15,17-19H2,(H-,24,27,28,29)/q+1/p+1 |
| InChIKey | KMVCZPGAIXMQQL-UHFFFAOYSA-O |
| XLogP | 3.32 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|