C19H31N3O6+2 — CID 172607888
2-[[1-(3,3-dimethyloctanoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium (PubChem CID 172607888) has the molecular formula C19H31N3O6+2 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[[1-(3,3-dimethyloctanoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium.
| Compound Name | 2-[[1-(3,3-dimethyloctanoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 172607888 |
| Molecular Formula | C19H31N3O6+2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-[[1-(3,3-dimethyloctanoyloxymethyl)pyridin-1-ium-3-carbonyl]amino]ethoxy-hydroxy-oxoazanium |
| SMILES | CCCCCC(C)(C)CC(=O)OC[n+]1cccc(C(=O)NCCO[N+](=O)O)c1 |
| InChI | InChI=1S/C19H30N3O6/c1-4-5-6-9-19(2,3)13-17(23)27-15-21-11-7-8-16(14-21)18(24)20-10-12-28-22(25)26/h7-8,11,14H,4-6,9-10,12-13,15H2,1-3H3,(H-,20,24,25,26)/q+1/p+1 |
| InChIKey | CACQGKXZWZHXHM-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|