C14H21N2O3+ — CID 58871716
1-[2-(hexylamino)-2-oxoethyl]pyridin-1-ium-3-carboxylic acid (PubChem CID 58871716) has the molecular formula C14H21N2O3+ and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-[2-(hexylamino)-2-oxoethyl]pyridin-1-ium-3-carboxylic acid.
| Compound Name | 1-[2-(hexylamino)-2-oxoethyl]pyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 58871716 |
| Molecular Formula | C14H21N2O3+ |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-[2-(hexylamino)-2-oxoethyl]pyridin-1-ium-3-carboxylic acid |
| SMILES | CCCCCCNC(=O)C[n+]1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-3-4-5-8-15-13(17)11-16-9-6-7-12(10-16)14(18)19/h6-7,9-10H,2-5,8,11H2,1H3,(H-,15,17,18,19)/p+1 |
| InChIKey | SCNNZBMQEBUAKN-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|