C15H19N4O8+ — CID 177333067
(2S)-1-[[3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methoxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 177333067) has the molecular formula C15H19N4O8+ and a molecular weight of 383.34 g/mol. Its IUPAC name is (2S)-1-[[3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methoxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methoxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 177333067 |
| Molecular Formula | C15H19N4O8+ |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (2S)-1-[[3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methoxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(NCCO[N+](=O)[O-])c1ccc[n+](COC(=O)N2CCC[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C15H18N4O8/c20-13(16-5-8-27-19(24)25)11-3-1-6-17(9-11)10-26-15(23)18-7-2-4-12(18)14(21)22/h1,3,6,9,12H,2,4-5,7-8,10H2,(H-,16,20,21,22)/p+1/t12-/m0/s1 |
| InChIKey | UVCZZPFQFRBONS-LBPRGKRZSA-O |
| XLogP | -0.44 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|