C15H21N4O6+ — CID 66555302
[3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl piperidine-1-carboxylate (PubChem CID 66555302) has the molecular formula C15H21N4O6+ and a molecular weight of 353.36 g/mol. Its IUPAC name is [3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl piperidine-1-carboxylate.
| Compound Name | [3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66555302 |
| Molecular Formula | C15H21N4O6+ |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [3-(2-nitrooxyethylcarbamoyl)pyridin-1-ium-1-yl]methyl piperidine-1-carboxylate |
| SMILES | O=C(NCCO[N+](=O)[O-])c1ccc[n+](COC(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C15H20N4O6/c20-14(16-6-10-25-19(22)23)13-5-4-7-17(11-13)12-24-15(21)18-8-2-1-3-9-18/h4-5,7,11H,1-3,6,8-10,12H2/p+1 |
| InChIKey | RJCAZQRFDZILAJ-UHFFFAOYSA-O |
| XLogP | 0.49 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|