About [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate
[5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate (PubChem CID 88996206) has the molecular formula C15H22N4O6
and a molecular weight of 354.36 g/mol. Its IUPAC name is [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate |
| PubChem CID | 88996206 |
| Molecular Formula | C15H22N4O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate |
| SMILES | O=C(NCCO[N+](=O)[O-])C1=CN(COC(=O)N2CCCCC2)CC=C1 |
| InChI | InChI=1S/C15H22N4O6/c20-14(16-6-10-25-19(22)23)13-5-4-7-17(11-13)12-24-15(21)18-8-2-1-3-9-18/h4-5,11H,1-3,6-10,12H2,(H,16,20) |
| InChIKey | DTEWDYWHVPHCPH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate?
The IUPAC name of [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate (CID 88996206) is [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate.
What is the SMILES notation for [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate?
The canonical SMILES for [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate is O=C(NCCO[N+](=O)[O-])C1=CN(COC(=O)N2CCCCC2)CC=C1.
What is the InChIKey of [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate?
The InChIKey is DTEWDYWHVPHCPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O6/c20-14(16-6-10-25-19(22)23)13-5-4-7-17(11-13)12-24-15(21)18-8-2-1-3-9-18/h4-5,11H,1-3,6-10,12H2,(H,16,20).
What are the key properties of [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate?
[5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate has a molecular weight of 354.36 g/mol, XLogP of 0.65, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-nitrooxyethylcarbamoyl)-2H-pyridin-1-yl]methyl piperidine-1-carboxylate is sourced from PubChem (CID 88996206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).