C21H23ClN2O6 — CID 10274598
2-[[1-(4-ethoxy-2,4-dioxobutyl)pyridin-1-ium-3-carbonyl]amino]ethyl benzoate chloride (PubChem CID 10274598) has the molecular formula C21H23ClN2O6 and a molecular weight of 434.88 g/mol. Its IUPAC name is 2-[[1-(4-ethoxy-2,4-dioxobutyl)pyridin-1-ium-3-carbonyl]amino]ethyl benzoate chloride.
| Compound Name | 2-[[1-(4-ethoxy-2,4-dioxobutyl)pyridin-1-ium-3-carbonyl]amino]ethyl benzoate chloride |
|---|---|
| PubChem CID | 10274598 |
| Molecular Formula | C21H23ClN2O6 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[[1-(4-ethoxy-2,4-dioxobutyl)pyridin-1-ium-3-carbonyl]amino]ethyl benzoate chloride |
| SMILES | CCOC(=O)CC(=O)C[n+]1cccc(C(=O)NCCOC(=O)c2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C21H22N2O6.ClH/c1-2-28-19(25)13-18(24)15-23-11-6-9-17(14-23)20(26)22-10-12-29-21(27)16-7-4-3-5-8-16;/h3-9,11,14H,2,10,12-13,15H2,1H3;1H |
| InChIKey | XHJTXNRJIQQWGE-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|