C19H33N4O5+ — CID 177029687
1-cyclohexyl-N-methylethanamine;[3-[2-(hydroxyamino)oxyethylcarbamoyl]pyridin-1-ium-1-yl]methyl formate (PubChem CID 177029687) has the molecular formula C19H33N4O5+ and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-cyclohexyl-N-methylethanamine;[3-[2-(hydroxyamino)oxyethylcarbamoyl]pyridin-1-ium-1-yl]methyl formate.
| Compound Name | 1-cyclohexyl-N-methylethanamine;[3-[2-(hydroxyamino)oxyethylcarbamoyl]pyridin-1-ium-1-yl]methyl formate |
|---|---|
| PubChem CID | 177029687 |
| Molecular Formula | C19H33N4O5+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-cyclohexyl-N-methylethanamine;[3-[2-(hydroxyamino)oxyethylcarbamoyl]pyridin-1-ium-1-yl]methyl formate |
| SMILES | CNC(C)C1CCCCC1.O=COC[n+]1cccc(C(=O)NCCONO)c1 |
| InChI | InChI=1S/C10H13N3O5.C9H19N/c14-8-17-7-13-4-1-2-9(6-13)10(15)11-3-5-18-12-16;1-8(10-2)9-6-4-3-5-7-9/h1-2,4,6,8,12,16H,3,5,7H2;8-10H,3-7H2,1-2H3/p+1 |
| InChIKey | BFSXYMHAKIUIJB-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|