About (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide
(4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide (PubChem CID 86717653) has the molecular formula C22H28IN3O5
and a molecular weight of 541.39 g/mol. Its IUPAC name is (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide |
| PubChem CID | 86717653 |
| Molecular Formula | C22H28IN3O5 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccc[n+](COC(=O)N(C(C)C)C(C)C)c2)cc1.[I-] |
| InChI | InChI=1S/C22H27N3O5.HI/c1-15(2)25(16(3)4)22(28)29-14-24-12-6-7-18(13-24)21(27)30-20-10-8-19(9-11-20)23-17(5)26;/h6-13,15-16H,14H2,1-5H3;1H |
| InChIKey | DONQHZRLERYCSF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide?
The IUPAC name of (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide (CID 86717653) is (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide.
What is the SMILES notation for (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide?
The canonical SMILES for (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide is CC(=O)Nc1ccc(OC(=O)c2ccc[n+](COC(=O)N(C(C)C)C(C)C)c2)cc1.[I-].
What is the InChIKey of (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide?
The InChIKey is DONQHZRLERYCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O5.HI/c1-15(2)25(16(3)4)22(28)29-14-24-12-6-7-18(13-24)21(27)30-20-10-8-19(9-11-20)23-17(5)26;/h6-13,15-16H,14H2,1-5H3;1H.
What are the key properties of (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide?
(4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide has a molecular weight of 541.39 g/mol, XLogP of 0.37, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 1-[di(propan-2-yl)carbamoyloxymethyl]pyridin-1-ium-3-carboxylate iodide is sourced from PubChem (CID 86717653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).