C36H42B2N4O8 — CID 100992928
[3-[6-[4-[[4-[6-(3-boronoanilino)-6-oxohexoxy]phenyl]diazenyl]phenoxy]hexanoylamino]phenyl]boronic acid (PubChem CID 100992928) has the molecular formula C36H42B2N4O8 and a molecular weight of 680.38 g/mol. Its IUPAC name is [3-[6-[4-[[4-[6-(3-boronoanilino)-6-oxohexoxy]phenyl]diazenyl]phenoxy]hexanoylamino]phenyl]boronic acid.
| Compound Name | [3-[6-[4-[[4-[6-(3-boronoanilino)-6-oxohexoxy]phenyl]diazenyl]phenoxy]hexanoylamino]phenyl]boronic acid |
|---|---|
| PubChem CID | 100992928 |
| Molecular Formula | C36H42B2N4O8 |
| Molecular Weight | 680.38 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | [3-[6-[4-[[4-[6-(3-boronoanilino)-6-oxohexoxy]phenyl]diazenyl]phenoxy]hexanoylamino]phenyl]boronic acid |
| SMILES | O=C(CCCCCOc1ccc(/N=N/c2ccc(OCCCCCC(=O)Nc3cccc(B(O)O)c3)cc2)cc1)Nc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C36H42B2N4O8/c43-35(39-31-11-7-9-27(25-31)37(45)46)13-3-1-5-23-49-33-19-15-29(16-20-33)41-42-30-17-21-34(22-18-30)50-24-6-2-4-14-36(44)40-32-12-8-10-28(26-32)38(47)48/h7-12,15-22,25-26,45-48H,1-6,13-14,23-24H2,(H,39,43)(H,40,44)/b42-41+ |
| InChIKey | ATFQVGPCNGNZOH-WQVHNPAPSA-N |
| XLogP | 4.62 |
| TPSA | 182.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|