C27H19NO9S3 — CID 90323322
4-O-[2-[4-(nitrooxymethyl)phenoxy]carbonylphenyl] 1-O-[4-(5-sulfanylidenedithiol-3-yl)phenyl] butanedioate (PubChem CID 90323322) has the molecular formula C27H19NO9S3 and a molecular weight of 597.65 g/mol. Its IUPAC name is 4-O-[2-[4-(nitrooxymethyl)phenoxy]carbonylphenyl] 1-O-[4-(5-sulfanylidenedithiol-3-yl)phenyl] butanedioate.
| Compound Name | 4-O-[2-[4-(nitrooxymethyl)phenoxy]carbonylphenyl] 1-O-[4-(5-sulfanylidenedithiol-3-yl)phenyl] butanedioate |
|---|---|
| PubChem CID | 90323322 |
| Molecular Formula | C27H19NO9S3 |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 597.02 |
| IUPAC Name | 4-O-[2-[4-(nitrooxymethyl)phenoxy]carbonylphenyl] 1-O-[4-(5-sulfanylidenedithiol-3-yl)phenyl] butanedioate |
| SMILES | O=C(CCC(=O)Oc1ccccc1C(=O)Oc1ccc(CO[N+](=O)[O-])cc1)Oc1ccc(-c2cc(=S)ss2)cc1 |
| InChI | InChI=1S/C27H19NO9S3/c29-24(35-19-11-7-18(8-12-19)23-15-26(38)40-39-23)13-14-25(30)37-22-4-2-1-3-21(22)27(31)36-20-9-5-17(6-10-20)16-34-28(32)33/h1-12,15H,13-14,16H2 |
| InChIKey | NIDJLHQXCOIXMK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|