C22H19N3O7S3 — CID 90323376
4-nitrooxybutyl 2-acetyloxy-4-[[4-(5-sulfanylidenedithiol-3-yl)phenyl]diazenyl]benzoate (PubChem CID 90323376) has the molecular formula C22H19N3O7S3 and a molecular weight of 533.61 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-acetyloxy-4-[[4-(5-sulfanylidenedithiol-3-yl)phenyl]diazenyl]benzoate.
| Compound Name | 4-nitrooxybutyl 2-acetyloxy-4-[[4-(5-sulfanylidenedithiol-3-yl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 90323376 |
| Molecular Formula | C22H19N3O7S3 |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | 4-nitrooxybutyl 2-acetyloxy-4-[[4-(5-sulfanylidenedithiol-3-yl)phenyl]diazenyl]benzoate |
| SMILES | CC(=O)Oc1cc(/N=N/c2ccc(-c3cc(=S)ss3)cc2)ccc1C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O7S3/c1-14(26)32-19-12-17(8-9-18(19)22(27)30-10-2-3-11-31-25(28)29)24-23-16-6-4-15(5-7-16)20-13-21(33)35-34-20/h4-9,12-13H,2-3,10-11H2,1H3/b24-23+ |
| InChIKey | BZTQXGLTJLMEIK-WCWDXBQESA-N |
| XLogP | 6.69 |
| TPSA | 129.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|